2-chloro-4-ethylsulfonylbenzoic acid structure
|
Common Name | 2-chloro-4-ethylsulfonylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 118939-05-2 | Molecular Weight | 248.68300 | |
| Density | 1.444g/cm3 | Boiling Point | 457.2ºC at 760mmHg | |
| Molecular Formula | C9H9ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | 2-chloro-4-ethylsulfonylbenzoic acid |
|---|
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 457.2ºC at 760mmHg |
| Molecular Formula | C9H9ClO4S |
| Molecular Weight | 248.68300 |
| Flash Point | 230.3ºC |
| Exact Mass | 247.99100 |
| PSA | 79.82000 |
| LogP | 2.91260 |
| Vapour Pressure | 3.74E-09mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | JPZAIINPMVVSEN-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
|
~%
2-chloro-4-ethy... CAS#:118939-05-2 |
| Literature: Brown, Richard W. Journal of Organic Chemistry, 1991 , vol. 56, # 16 p. 4974 - 4976 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |