methyl 4-fluoro-3-phenoxybenzoate structure
|
Common Name | methyl 4-fluoro-3-phenoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 117252-08-1 | Molecular Weight | 246.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-fluoro-3-phenoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11FO3 |
|---|---|
| Molecular Weight | 246.23400 |
| Exact Mass | 246.06900 |
| PSA | 35.53000 |
| LogP | 3.40460 |
| InChIKey | JYKULQBXNKHHEF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(F)c(Oc2ccccc2)c1 |
|
~%
methyl 4-fluoro... CAS#:117252-08-1 |
| Literature: Mohan; Vishalakshi; Bhat; Rao; Kendappa Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 8 p. 1798 - 1801 |
|
~%
methyl 4-fluoro... CAS#:117252-08-1 |
| Literature: Mohan; Vishalakshi; Bhat; Rao; Kendappa Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 8 p. 1798 - 1801 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-fluoro-3-phenoxybenzoic acid methyl ester |
| 4-Fluoro-3-phenoxy-benzoic acid |
| Benzoic acid,4-fluoro-3-phenoxy-,methyl ester |