1-(azidomethyl)-3-phenylpyrazole-4-carbonitrile structure
|
Common Name | 1-(azidomethyl)-3-phenylpyrazole-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 117007-81-5 | Molecular Weight | 224.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(azidomethyl)-3-phenylpyrazole-4-carbonitrile |
|---|
| Molecular Formula | C11H8N6 |
|---|---|
| Molecular Weight | 224.22100 |
| Exact Mass | 224.08100 |
| PSA | 91.36000 |
| LogP | 2.14234 |
| InChIKey | HXWICAKROIAOEL-UHFFFAOYSA-N |
| SMILES | N#Cc1cn(CN=[N+]=[N-])nc1-c1ccccc1 |
|
~22%
1-(azidomethyl)... CAS#:117007-81-5 |
| Literature: Becher, Jan; Joergensen, Per Lauge; Pluta, Krystian; Krake, Niels J.; Faelt-Hansen, Birgitte Journal of Organic Chemistry, 1992 , vol. <7> 57, p. 2127 - 2134 |
|
~%
1-(azidomethyl)... CAS#:117007-81-5 |
| Literature: Becher, Jan; Broendum, Klaus; Krake, Niels; Pluta, Krystian; Simonsen, Ole; et al. Journal of the Chemical Society, Chemical Communications, 1988 , # 8 p. 541 - 542 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |