sodium salt of 2-methylthio-6-nitro-7-oxo-4,7-dihydro-1,2,4-triazolo<5,1-c><1,2,4>triazine structure
|
Common Name | sodium salt of 2-methylthio-6-nitro-7-oxo-4,7-dihydro-1,2,4-triazolo<5,1-c><1,2,4>triazine | ||
|---|---|---|---|---|
| CAS Number | 116061-59-7 | Molecular Weight | 250.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3N6NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium salt of 2-methylthio-6-nitro-7-oxo-4,7-dihydro-1,2,4-triazolo<5,1-c><1,2,4>triazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H3N6NaO3S |
|---|---|
| Molecular Weight | 250.17000 |
| Exact Mass | 249.98900 |
| PSA | 144.16000 |
| InChIKey | LHFCTECILQWPDR-UHFFFAOYSA-M |
| SMILES | CSc1nc2nnc([N+](=O)[O-])c([O-])n2n1.[Na+] |
| sodium salt of 2-methylthio-6-nitro-7-oxo-4,7-dihydro-1,2,4-triazolo[5,1-c][1,2,4]triazine |