1-(2-phenylhydrazinyl)naphthalene-2,6-dione structure
|
Common Name | 1-(2-phenylhydrazinyl)naphthalene-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 115440-09-0 | Molecular Weight | 264.27900 | |
| Density | 1.32g/cm3 | Boiling Point | 431.6ºC at 760mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | 1-(2-phenylhydrazinyl)naphthalene-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 431.6ºC at 760mmHg |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 168.5ºC |
| Exact Mass | 264.09000 |
| PSA | 58.20000 |
| LogP | 2.52530 |
| Vapour Pressure | 1.18E-07mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | JVWRDWIVNBPMRR-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(N=Nc3ccccc3)c(O)ccc2c1 |
|
~%
1-(2-phenylhydr... CAS#:115440-09-0 |
| Literature: Stiborova, Marie; Asfaw, Befekadu; Frei, Eva; Schmeiser, Heinz H.; Wiessler, Manfred Collection of Czechoslovak Chemical Communications, 1994 , vol. 59, # 12 p. 2727 - 2733 |
|
~%
1-(2-phenylhydr... CAS#:115440-09-0 |
| Literature: Kehrmann Chemische Berichte, 1907 , vol. 40, p. 1962 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-phenylazo-naphthalene-2,6-diol |
| 1-Benzolazo-2.6-dioxy-naphthalin |
| 6-OH-Sudan I |
| 1-Phenylazo-2,6-dihydroxynaphthalene |
| 1-Phenylazo-naphthalin-2,6-diol |