8-Phenyl-1,3-diazaspiro[4.5]decane-2,4-dione structure
|
Common Name | 8-Phenyl-1,3-diazaspiro[4.5]decane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 115005-77-1 | Molecular Weight | 244.28900 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Phenyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 65.18000 |
| LogP | 1.83830 |
| Index of Refraction | 1.608 |
| InChIKey | XZICMHSYLIZUJO-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CCC(c3ccccc3)CC2)N1 |
| HS Code | 2933990090 |
|---|
|
~69%
8-Phenyl-1,3-di... CAS#:115005-77-1 |
| Literature: Courtoison; Coudert; Couquelet; Tronche; Jonadet; Bastide Farmaco, Edizione Scientifica, 1988 , vol. 43, # 2 p. 153 - 160 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Diazaspiro(4.5)decane-2,4-dione,8-phenyl |
| 8-Phenyl-1,3-diazaspiro(4.5)decane-2,4-dione |