3-Oxo-1-cyclohexen-1-yl 2-chloro-4-(methylsulfonyl)benzoate structure
|
Common Name | 3-Oxo-1-cyclohexen-1-yl 2-chloro-4-(methylsulfonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 114911-83-0 | Molecular Weight | 328.76800 | |
| Density | 1.45g/cm3 | Boiling Point | 545.1ºC at 760 mmHg | |
| Molecular Formula | C14H13ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.5ºC | |
| Name | 3-Oxo-1-cyclohexen-1-yl 2-chloro-4-(methylsulfonyl)benzoate |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 545.1ºC at 760 mmHg |
| Molecular Formula | C14H13ClO5S |
| Molecular Weight | 328.76800 |
| Flash Point | 283.5ºC |
| Exact Mass | 328.01700 |
| PSA | 85.89000 |
| LogP | 3.61800 |
| Vapour Pressure | 6.11E-12mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | KZYIXYSUABRQCR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OC2=CC(=O)CCC2)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |