[[2-(2,2-Dimethylhydrazino)-2-oxoethyl]-(4-methoxyphenyl)amino]acetic acid
Modify Date: 2025-08-25 19:27:06
![[[2-(2,2-Dimethylhydrazino)-2-oxoethyl]-(4-methoxyphenyl)amino]acetic acid Structure](https://image.chemsrc.com/caspic/489/1142204-24-7.png)
[[2-(2,2-Dimethylhydrazino)-2-oxoethyl]-(4-methoxyphenyl)amino]acetic acid structure
|
Common Name | [[2-(2,2-Dimethylhydrazino)-2-oxoethyl]-(4-methoxyphenyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1142204-24-7 | Molecular Weight | 281.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[2-(2,2-Dimethylhydrazino)-2-oxoethyl]-(4-methoxyphenyl)amino]acetic acid |
|---|
| Molecular Formula | C13H19N3O4 |
|---|---|
| Molecular Weight | 281.30800 |
| Exact Mass | 281.13800 |
| PSA | 82.11000 |
| LogP | 0.56990 |
| InChIKey | QEFMXUYVHJIRFZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)NN(C)C)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |