tert-Butyl (5-methoxypyridine-3,4-diyl)bis(methylene)dicarbamate structure
|
Common Name | tert-Butyl (5-methoxypyridine-3,4-diyl)bis(methylene)dicarbamate | ||
|---|---|---|---|---|
| CAS Number | 1142191-99-8 | Molecular Weight | 367.44000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29N3O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | tert-Butyl (5-methoxypyridine-3,4-diyl)bis(methylene)dicarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29N3O5 |
|---|---|
| Molecular Weight | 367.44000 |
| Exact Mass | 367.21100 |
| PSA | 98.78000 |
| LogP | 3.92140 |
| InChIKey | KMPFQRUNLAVRPO-UHFFFAOYSA-N |
| SMILES | COc1cncc(CNC(=O)OC(C)(C)C)c1CNC(=O)OC(C)(C)C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl N-[[3-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridin-4-yl]methyl]carbamate |