1-N,4-N-bis(2-methyl-2-nitropropyl)benzene-1,4-diamine
Modify Date: 2025-10-21 10:36:45
1-N,4-N-bis(2-methyl-2-nitropropyl)benzene-1,4-diamine structure
|
Common Name | 1-N,4-N-bis(2-methyl-2-nitropropyl)benzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 114136-86-6 | Molecular Weight | 310.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N,4-N-bis(2-methyl-2-nitropropyl)benzene-1,4-diamine |
|---|
| Molecular Formula | C14H22N4O4 |
|---|---|
| Molecular Weight | 310.34900 |
| Exact Mass | 310.16400 |
| PSA | 115.70000 |
| LogP | 3.81340 |
| InChIKey | ZGPWHRJZRHQLGC-UHFFFAOYSA-N |
| SMILES | CC(C)(CNc1ccc(NCC(C)(C)[N+](=O)[O-])cc1)[N+](=O)[O-] |
|
~%
1-N,4-N-bis(2-m... CAS#:114136-86-6 |
| Literature: SUMITOMO CHEMICAL COMPANY, LIMITED Patent: EP391733 B1, 1994 ; |
|
~%
1-N,4-N-bis(2-m... CAS#:114136-86-6 |
| Literature: Johnson Journal of the American Chemical Society, 1946 , vol. 68, p. 14,16 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |