5-(4-chlorophenyl)-2-ethyl-4-methyl-1,2,4-triazol-3-one structure
|
Common Name | 5-(4-chlorophenyl)-2-ethyl-4-methyl-1,2,4-triazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 114058-88-7 | Molecular Weight | 237.68500 | |
| Density | 1.29g/cm3 | Boiling Point | 308.1ºC at 760mmHg | |
| Molecular Formula | C11H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.1ºC | |
| Name | 5-(4-chlorophenyl)-2-ethyl-4-methyl-1,2,4-triazol-3-one |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 308.1ºC at 760mmHg |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.68500 |
| Flash Point | 140.1ºC |
| Exact Mass | 237.06700 |
| PSA | 39.82000 |
| LogP | 1.92210 |
| Vapour Pressure | 0.000697mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | ADCONTZNUSIGEG-UHFFFAOYSA-N |
| SMILES | CCn1nc(-c2ccc(Cl)cc2)n(C)c1=O |
|
~51%
5-(4-chlorophen... CAS#:114058-88-7 |
| Literature: Kane, John M. Synthesis, 1987 , # 10 p. 912 - 914 |
|
~%
5-(4-chlorophen... CAS#:114058-88-7 |
| Literature: Kane; Baron; Dudley; Sorensen; Staeger; Miller Journal of Medicinal Chemistry, 1990 , vol. 33, # 10 p. 2772 - 2777 |
|
~%
5-(4-chlorophen... CAS#:114058-88-7 |
| Literature: Kane, John M. Synthesis, 1987 , # 10 p. 912 - 914 |