2-(1-bromoethyl)-3-chloronaphthalene-1,4-dione structure
|
Common Name | 2-(1-bromoethyl)-3-chloronaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 113822-91-6 | Molecular Weight | 299.54800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-bromoethyl)-3-chloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8BrClO2 |
|---|---|
| Molecular Weight | 299.54800 |
| Exact Mass | 297.94000 |
| PSA | 34.14000 |
| LogP | 3.34190 |
| InChIKey | CGTDOQMDENWXLN-UHFFFAOYSA-N |
| SMILES | CC(Br)C1=C(Cl)C(=O)c2ccccc2C1=O |
|
~%
2-(1-bromoethyl... CAS#:113822-91-6 |
| Literature: Khanna, Rajinda N.; Sharma, Pavan K.; Thomson, Ronald H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1821 - 1824 |
| 2-(1-bromoethyl)-3-chloro-1,4-naphthoquinone |
| 1,4-Naphthalenedione,2-(1-bromoethyl)-3-chloro |