methyl 5-bromo-2-methoxy-4-phenylbenzoate structure
|
Common Name | methyl 5-bromo-2-methoxy-4-phenylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 1131587-95-5 | Molecular Weight | 321.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-bromo-2-methoxy-4-phenylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13BrO3 |
|---|---|
| Molecular Weight | 321.16600 |
| Exact Mass | 320.00500 |
| PSA | 35.53000 |
| LogP | 3.91130 |
| InChIKey | BLOMJPDEQOVQSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)c(-c2ccccc2)cc1OC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-bromo-5-methoxybiphenyl-4-carboxylate |
| methyl 5-bromanyl-2-methoxy-4-phenyl-benzoate |