5-ethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-57-0 | Molecular Weight | 337.31500 | |
| Density | 1.45g/cm3 | Boiling Point | 412.2ºC at 760mmHg | |
| Molecular Formula | C13H14F3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 5-ethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 412.2ºC at 760mmHg |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.31500 |
| Flash Point | 203.1ºC |
| Exact Mass | 337.06000 |
| PSA | 72.06000 |
| LogP | 3.39780 |
| Vapour Pressure | 5.26E-07mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | IRFAAQZNCFVTRS-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
|
~%
5-ethoxy-1-[3-(... CAS#:111711-57-0 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,5-ethoxy-1-((3-(trifluoromethyl)phenyl)sulfonyl) |
| 5-Ethoxy-1-((3-(trifluoromethyl)phenyl)sulfonyl)-2-pyrrolidinone |