2-[2-(2-amino-4-fluorophenoxy)ethoxy]-5-fluoroaniline structure
|
Common Name | 2-[2-(2-amino-4-fluorophenoxy)ethoxy]-5-fluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 111040-95-0 | Molecular Weight | 280.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(2-amino-4-fluorophenoxy)ethoxy]-5-fluoroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14F2N2O2 |
|---|---|
| Molecular Weight | 280.27000 |
| Exact Mass | 280.10200 |
| PSA | 70.50000 |
| LogP | 3.74940 |
| InChIKey | HDERDLSMDVCGKW-UHFFFAOYSA-N |
| SMILES | Nc1cc(F)ccc1OCCOc1ccc(F)cc1N |
|
~%
2-[2-(2-amino-4... CAS#:111040-95-0 |
| Literature: Smith, Gerry A.; Kirschenlohr, Heide L.; Metcalfe, James C.; Clarke, Sonia D. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 6 p. 1205 - 1210 |
|
~%
2-[2-(2-amino-4... CAS#:111040-95-0 |
| Literature: Smith, Gerry A.; Kirschenlohr, Heide L.; Metcalfe, James C.; Clarke, Sonia D. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 6 p. 1205 - 1210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenamine,2,2'-[1,2-ethanediylbis(oxy)]bis[5-fluoro |