lithium,4-(2-chloroethyl)-1,2-dimethoxybenzene-5-ide structure
|
Common Name | lithium,4-(2-chloroethyl)-1,2-dimethoxybenzene-5-ide | ||
|---|---|---|---|---|
| CAS Number | 110905-09-4 | Molecular Weight | 206.59500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClLiO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | lithium,4-(2-chloroethyl)-1,2-dimethoxybenzene-5-ide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12ClLiO2 |
|---|---|
| Molecular Weight | 206.59500 |
| Exact Mass | 206.06900 |
| PSA | 18.46000 |
| LogP | 2.41910 |
| InChIKey | JZLGTUQOQMADDN-UHFFFAOYSA-N |
| SMILES | COc1c[c-]c(CCCl)cc1OC.[Li+] |
|
~%
lithium,4-(2-ch... CAS#:110905-09-4 |
| Literature: Chou, Chun-Tzer; Swenton, John S. Journal of the American Chemical Society, 1987 , vol. 109, # 22 p. 6898 - 6899 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [2-(2-chloroethyl)-4,5-dimethoxyphenyl]lithium |
| lithium, 4-(2-chloroethyl)-1,2-dimethoxybenzene-5-ide |
| Lithium,[2-(2-chloroethyl)-4,5-dimethoxyphenyl] |