N,N-dimethyl-2-(5-methyl-4-thiophen-2-ylpyrimidin-2-yl)sulfanylethanamine structure
|
Common Name | N,N-dimethyl-2-(5-methyl-4-thiophen-2-ylpyrimidin-2-yl)sulfanylethanamine | ||
|---|---|---|---|---|
| CAS Number | 109628-22-0 | Molecular Weight | 279.42400 | |
| Density | 1.22g/cm3 | Boiling Point | 398.2ºC at 760mmHg | |
| Molecular Formula | C13H17N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6ºC | |
| Name | N,N-dimethyl-2-(5-methyl-4-thiophen-2-ylpyrimidin-2-yl)sulfanylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760mmHg |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.42400 |
| Flash Point | 194.6ºC |
| Exact Mass | 279.08600 |
| PSA | 82.56000 |
| LogP | 3.16720 |
| Vapour Pressure | 1.5E-06mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | JZBPDNYBZKUOFN-UHFFFAOYSA-N |
| SMILES | Cc1cnc(SCCN(C)C)nc1-c1cccs1 |
|
~%
N,N-dimethyl-2-... CAS#:109628-22-0 |
| Literature: Strekowski, Lucjan; Mokrosz, Jerzy L.; Tanious, Farial A.; Watson, Rebecca A.; Harden, Donald; et al. Journal of Medicinal Chemistry, 1988 , vol. 31, # 6 p. 1231 - 1240 |
|
~%
N,N-dimethyl-2-... CAS#:109628-22-0 |
| Literature: Strekowski, Lucjan; Mokrosz, Jerzy L.; Tanious, Farial A.; Watson, Rebecca A.; Harden, Donald; et al. Journal of Medicinal Chemistry, 1988 , vol. 31, # 6 p. 1231 - 1240 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-2-((5-methyl-4-(2-thienyl)-2-pyrimidinyl)thio)ethanamine |
| N,N-dimethyl-2-[(5'-methyl-4'-thien-2''-ylpyrimidin-2'-yl)thio]ethylamine |
| N,N-dimethyl-2-{[5-methyl-4-(thiophen-2-yl)pyrimidin-2-yl]sulfanyl}ethanamine |