methyl 1,2-dihydro-3H-4-(2-hydroxy-2-propyl)-5-methoxypyrrolo[3,2-e]indole-7-carboxylate structure
|
Common Name | methyl 1,2-dihydro-3H-4-(2-hydroxy-2-propyl)-5-methoxypyrrolo[3,2-e]indole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 107890-43-7 | Molecular Weight | 304.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1,2-dihydro-3H-4-(2-hydroxy-2-propyl)-5-methoxypyrrolo[3,2-e]indole-7-carboxylate |
|---|
| Molecular Formula | C16H20N2O4 |
|---|---|
| Molecular Weight | 304.34100 |
| Exact Mass | 304.14200 |
| PSA | 83.58000 |
| LogP | 2.29650 |
| InChIKey | JJDNJSMRHALPGB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2c3c(c(C(C)(C)O)c(OC)c2[nH]1)NCC3 |
|
~%
methyl 1,2-dihy... CAS#:107890-43-7 |
| Literature: Boger,D.L.; Coleman,R.S. Journal of the American Chemical Society, 1987 , vol. 109, p. 2717 |
|
~%
methyl 1,2-dihy... CAS#:107890-43-7 |
| Literature: Boger,D.L.; Coleman,R.S. Journal of the American Chemical Society, 1987 , vol. 109, p. 2717 |