N-[bis(2-methylpropoxy)phosphoryl]aniline
Modify Date: 2025-08-26 17:08:30
![N-[bis(2-methylpropoxy)phosphoryl]aniline Structure](https://image.chemsrc.com/caspic/335/106841-87-6.png)
N-[bis(2-methylpropoxy)phosphoryl]aniline structure
|
Common Name | N-[bis(2-methylpropoxy)phosphoryl]aniline | ||
|---|---|---|---|---|
| CAS Number | 106841-87-6 | Molecular Weight | 285.31900 | |
| Density | 1.088g/cm3 | Boiling Point | 345.7ºC at 760mmHg | |
| Molecular Formula | C14H24NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.9ºC | |
| Name | N-[bis(2-methylpropoxy)phosphoryl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 345.7ºC at 760mmHg |
| Molecular Formula | C14H24NO3P |
| Molecular Weight | 285.31900 |
| Flash Point | 162.9ºC |
| Exact Mass | 285.14900 |
| PSA | 57.37000 |
| LogP | 4.62480 |
| Vapour Pressure | 6.03E-05mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | YTXJKISHOJJDOK-UHFFFAOYSA-N |
| SMILES | CC(C)COP(=O)(Nc1ccccc1)OCC(C)C |
|
~70%
N-[bis(2-methyl... CAS#:106841-87-6 |
| Literature: Ilia, Gheorghe; Petric, Mihaela; Macarie, Lavinia; Iliescu, Smaranda; Popa, Adriana Phosphorus, Sulfur and Silicon and the Related Elements, 2006 , vol. 181, # 7 p. 1717 - 1723 |
|
~%
N-[bis(2-methyl... CAS#:106841-87-6 |
| Literature: Cook; McCombie; Saunders Journal of the Chemical Society, 1945 , p. 874 |
|
~%
N-[bis(2-methyl... CAS#:106841-87-6 |
| Literature: Cook; McCombie; Saunders Journal of the Chemical Society, 1945 , p. 874 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| phenyl-amidophosphoric acid diisobutyl ester |
| Diisobutyl anilidophosphate |
| Phenyl-amidophosphorsaeure-diisobutylester |
| Phosphoramidic acid,phenyl-,diisobutyl ester |
| Phenylphosphoramidic acid diisobutyl ester |