methyl 4-[N-hydroxy-3-(quinolin-2-ylmethoxy)anilino]-4-oxobutanoate structure
|
Common Name | methyl 4-[N-hydroxy-3-(quinolin-2-ylmethoxy)anilino]-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 105785-61-3 | Molecular Weight | 380.39400 | |
| Density | 1.324g/cm3 | Boiling Point | 587.4ºC at 760mmHg | |
| Molecular Formula | C21H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.1ºC | |
| Name | methyl 4-[N-hydroxy-3-(quinolin-2-ylmethoxy)anilino]-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 587.4ºC at 760mmHg |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.39400 |
| Flash Point | 309.1ºC |
| Exact Mass | 380.13700 |
| PSA | 88.96000 |
| LogP | 3.48920 |
| Vapour Pressure | 1.21E-14mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | KWMZKEYRUAAKNW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)N(O)c1cccc(OCc2ccc3ccccc3n2)c1 |
|
~%
methyl 4-[N-hyd... CAS#:105785-61-3 |
| Literature: Musser; Kubrak; Chang; Lewis Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1429 - 1435 |
|
~%
methyl 4-[N-hyd... CAS#:105785-61-3 |
| Literature: Musser; Kubrak; Chang; Lewis Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1429 - 1435 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Wy-45,911 |