[1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate structure
|
Common Name | [1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 10571-59-2 | Molecular Weight | 289.75700 | |
| Density | 1.188g/cm3 | Boiling Point | 390.1ºC at 760mmHg | |
| Molecular Formula | C16H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | [1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760mmHg |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.75700 |
| Flash Point | 189.7ºC |
| Exact Mass | 289.08700 |
| PSA | 39.19000 |
| LogP | 4.28910 |
| Vapour Pressure | 2.72E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | XPPXHQUWVYMTDM-UHFFFAOYSA-N |
| SMILES | CC(C)C(OC(=O)c1cccnc1)c1ccc(Cl)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nicoclonatum |
| Nicoclonatum [INN-Latin] |
| Nicoclonato [INN-Spanish] |
| Nicoclonol |
| p-Chlorphenyl-isopropylcarbinol-nicotinat |
| 1-(p-chlorophenyl)-isobutyl nicotinate |
| Nicoclonate |
| 3-pyridinecarboxylic acid 1-(4-chlorophenyl)-2-methylpropyl ester |
| p-Chlorphenyl-isopropylcarbinol-nikotinat |
| Nicoclonato |