(2,4-Dimethoxy-benzyl)-(4-fluoro-benzyl)-amine hydrobromide structure
|
Common Name | (2,4-Dimethoxy-benzyl)-(4-fluoro-benzyl)-amine hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 1051369-28-8 | Molecular Weight | 356.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4-Dimethoxy-benzyl)-(4-fluoro-benzyl)-amine hydrobromide |
|---|
| Molecular Formula | C16H19BrFNO2 |
|---|---|
| Molecular Weight | 356.23000 |
| Exact Mass | 355.05800 |
| PSA | 30.49000 |
| LogP | 4.48170 |
| InChIKey | NEIWABMEZVDLKH-UHFFFAOYSA-N |
| SMILES | Br.COc1ccc(CNCc2ccc(F)cc2)c(OC)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |