methyl 2-trimethylstannylcycloheptene-1-carboxylate structure
|
Common Name | methyl 2-trimethylstannylcycloheptene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 104803-39-6 | Molecular Weight | 320.02700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-trimethylstannylcycloheptene-1-carboxylate |
|---|
| Molecular Formula | C12H25O2Sn |
|---|---|
| Molecular Weight | 320.02700 |
| Exact Mass | 321.08800 |
| PSA | 26.30000 |
| LogP | 3.38060 |
| InChIKey | STHQZULKPULSGZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C([Sn](C)(C)C)CCCCC1 |
|
~%
methyl 2-trimet... CAS#:104803-39-6 |
| Literature: Piers, Edward; Skerlj, Renato T. Journal of the Chemical Society, Chemical Communications, 1986 , # 8 p. 626 - 627 |
|
~%
methyl 2-trimet... CAS#:104803-39-6 |
| Literature: Piers, Edward Pure and Applied Chemistry, 1988 , vol. 60, p. 107 - 114 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |