(2E)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid structure
|
Common Name | (2E)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 10465-70-0 | Molecular Weight | 258.70000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClO2 |
|---|---|
| Molecular Weight | 258.70000 |
| Exact Mass | 258.04500 |
| PSA | 37.30000 |
| LogP | 3.96520 |
| InChIKey | VPXGAYMGNMHRTI-UVTDQMKNSA-N |
| SMILES | O=C(O)C(=Cc1ccccc1)c1ccc(Cl)cc1 |
|
~%
(2E)-2-(4-chlor... CAS#:10465-70-0 |
| Literature: Koelsch; Boekelheide Journal of the American Chemical Society, 1944 , vol. 66, p. 412,414 |
|
~%
(2E)-2-(4-chlor... CAS#:10465-70-0 |
| Literature: Koelsch; Boekelheide Journal of the American Chemical Society, 1944 , vol. 66, p. 412,414 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-(4-chlorophenyl)-3-phenylpropenoic acid |
| (E)-2-(4-chlorophenyl)-3-phenylpropenoic acid |
| 3t-Phenyl-2-(4-chlor-phenyl)-acrylsaeure |
| 2-(4-chloro-phenyl)-3t-phenyl-acrylic acid |
| 2-(4-Chlor-phenyl)-3t-phenyl-acrylsaeure |