2-diethoxyphosphorylsulfanylethyl-dimethyl-phenylazanium
Modify Date: 2025-09-22 15:04:28
2-diethoxyphosphorylsulfanylethyl-dimethyl-phenylazanium structure
|
Common Name | 2-diethoxyphosphorylsulfanylethyl-dimethyl-phenylazanium | ||
|---|---|---|---|---|
| CAS Number | 10463-80-6 | Molecular Weight | 318.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-diethoxyphosphorylsulfanylethyl-dimethyl-phenylazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25NO3PS |
|---|---|
| Molecular Weight | 318.39200 |
| Exact Mass | 318.12900 |
| PSA | 70.64000 |
| LogP | 4.16780 |
| InChIKey | HGIXORYWYKVOMY-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SCC[N+](C)(C)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| gt 161 |