4,7-dimethyl-1H-indole-2-carboxylic acid structure
|
Common Name | 4,7-dimethyl-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103988-96-1 | Molecular Weight | 189.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,7-dimethyl-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21100 |
| Exact Mass | 189.07900 |
| PSA | 53.09000 |
| LogP | 2.48290 |
| InChIKey | DXGLNXJHHJNUHD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2[nH]c(C(=O)O)cc12 |
| HS Code | 2933990090 |
|---|
|
~%
4,7-dimethyl-1H... CAS#:103988-96-1 |
| Literature: Carlin et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 5712,5715 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Dimethyl-indol-2-carbonsaeure |
| 4,7-dimethylindole-2-carboxylate |
| 1H-Indole-2-carboxylicacid,4,7-dimethyl |
| 4,7-dimethyl-indole-2-carboxylic acid |