PD 113413 structure
|
Common Name | PD 113413 | ||
|---|---|---|---|---|
| CAS Number | 103733-50-2 | Molecular Weight | 392.45 | |
| Density | 1.33g/cm3 | Boiling Point | 669.8ºC at 760mmHg | |
| Molecular Formula | C23H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.9ºC | |
Use of PD 113413PD 113413 is formed by subsequent hydrolysis of the diketopiperazine quinapril analog. PD 113413 is a potent angiotensin-converting enzyme inhibitor. PD 113413 can be used for research of hypertension and congestive heart failure[1]. |
| Name | (2S)-2-[(3S,11aS)-3-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-phenylbutanoic acid |
|---|
| Description | PD 113413 is formed by subsequent hydrolysis of the diketopiperazine quinapril analog. PD 113413 is a potent angiotensin-converting enzyme inhibitor. PD 113413 can be used for research of hypertension and congestive heart failure[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 669.8ºC at 760mmHg |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 |
| Flash Point | 358.9ºC |
| Exact Mass | 392.17400 |
| PSA | 77.92000 |
| LogP | 2.13240 |
| Vapour Pressure | 7.46E-19mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | VXPDBIKOLFNDKU-YSSFQJQWSA-N |
| SMILES | CC1C(=O)N2Cc3ccccc3CC2C(=O)N1C(CCc1ccccc1)C(=O)O |