(4-tert-butylphenyl)-(4-nitrophenyl)methanone structure
|
Common Name | (4-tert-butylphenyl)-(4-nitrophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 10372-92-6 | Molecular Weight | 283.32200 | |
| Density | 1.151g/cm3 | Boiling Point | 426.3ºC at 760mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | (4-tert-butylphenyl)-(4-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 426.3ºC at 760mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 192.2ºC |
| Exact Mass | 283.12100 |
| PSA | 62.89000 |
| LogP | 4.64650 |
| Vapour Pressure | 1.8E-07mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | KKYQYRVNPAHJNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~68%
(4-tert-butylph... CAS#:10372-92-6 |
| Literature: Carmellino, Maria L.; Pagani, Giuseppe; Pregnolato, Massimo; Terreni, Marco; Caprioli, Vincenzo; Zani, Franca Pesticide Science, 1995 , vol. 45, # 3 p. 227 - 236 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Benzophenone,4-tert-butyl-4'-nitro |
| 4-Nitro-4'-tert.-butyl-benzophenon |
| 4-TERT-BUTYL-4'-NITROBENZOPHENONE |