5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylic acid structure
|
Common Name | 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103053-08-3 | Molecular Weight | 265.65300 | |
| Density | 1.59g/cm3 | Boiling Point | 533.2ºC at 760mmHg | |
| Molecular Formula | C11H8ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3ºC | |
| Name | 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 533.2ºC at 760mmHg |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.65300 |
| Flash Point | 276.3ºC |
| Exact Mass | 265.02500 |
| PSA | 98.21000 |
| LogP | 2.02310 |
| Vapour Pressure | 3.36E-12mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | RGGCHHCVNLUMKH-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(C(=O)O)cnn1-c1cccc(Cl)c1 |
|
~89%
5-carbamoyl-1-(... CAS#:103053-08-3 |
| Literature: Beck, James R.; Lynch, Michael P.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 555 - 558 |
|
~%
5-carbamoyl-1-(... CAS#:103053-08-3 |
| Literature: Beck, James R.; Lynch, Michael P.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 555 - 558 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-(Aminocarbonyl)-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylic acid |
| 5-carbamoyl-1-(3-chlorophenyl)-1h-pyrazole-4-carboxylic acid |
| 4-carboxy-1-(3-chlorophenyl)-5-pyrazolecarboxamide |
| 1H-Pyrazole-4-carboxylic acid,5-(aminocarbonyl)-1-(3-chlorophenyl) |