1,3-diisocyanato-2-methylbenzene,ethane-1,2-diamine,2-methyloxirane structure
|
Common Name | 1,3-diisocyanato-2-methylbenzene,ethane-1,2-diamine,2-methyloxirane | ||
|---|---|---|---|---|
| CAS Number | 103051-65-6 | Molecular Weight | 292.33400 | |
| Density | N/A | Boiling Point | 248.4ºC at 760mmHg | |
| Molecular Formula | C14H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.5ºC | |
| Name | 1,3-diisocyanato-2-methylbenzene,ethane-1,2-diamine,2-methyloxirane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 248.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.33400 |
| Flash Point | 110.5ºC |
| Exact Mass | 292.15400 |
| PSA | 123.43000 |
| LogP | 2.63910 |
| Vapour Pressure | 0.0243mmHg at 25°C |
| InChIKey | CBIYHEVUZBOQQO-UHFFFAOYSA-N |
| SMILES | CC1CO1.Cc1c(N=C=O)cccc1N=C=O.NCCN |
| 1,2-Ethanediamine,polymer with 1,3-diisocyanatomethylbenzene and 2-methyloxirane |
| 1,2-Ethanediamine,polymer with 1,3-diisocyanatomethylbenzene and methyloxirane |