1-[4-(2-methylphenyl)piperazin-1-yl]ethanone
Modify Date: 2025-09-15 18:57:27
![1-[4-(2-methylphenyl)piperazin-1-yl]ethanone Structure](https://image.chemsrc.com/caspic/154/101975-77-3.png)
1-[4-(2-methylphenyl)piperazin-1-yl]ethanone structure
|
Common Name | 1-[4-(2-methylphenyl)piperazin-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 101975-77-3 | Molecular Weight | 218.29500 | |
| Density | 1.089g/cm3 | Boiling Point | 385ºC at 760mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | 1-[4-(2-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 385ºC at 760mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 172.7ºC |
| Exact Mass | 218.14200 |
| PSA | 23.55000 |
| LogP | 1.66640 |
| Vapour Pressure | 3.92E-06mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | JBTQRFMTDYRGLH-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(c2ccccc2C)CC1 |
|
~%
1-[4-(2-methylp... CAS#:101975-77-3 |
| Literature: Pollard; Wicker Journal of the American Chemical Society, 1954 , vol. 76, p. 1853 |
|
~%
1-[4-(2-methylp... CAS#:101975-77-3 |
| Literature: Pollard; Wicker Journal of the American Chemical Society, 1954 , vol. 76, p. 1853 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Piperazine,1-acetyl-4-o-tolyl |
| ethanone,1-[4-(2-methylphenyl)-1-piperazinyl] |
| 1-acetyl-4-o-tolyl-piperazine |
| 4-Acetyl-1-o-tolylpiperazine |