2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]propanedinitrile
Modify Date: 2025-09-17 17:02:42
![2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]propanedinitrile Structure](https://image.chemsrc.com/caspic/229/101756-41-6.png)
2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]propanedinitrile structure
|
Common Name | 2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 101756-41-6 | Molecular Weight | 260.24900 | |
| Density | 1.19g/cm3 | Boiling Point | 376.3ºC at 760mmHg | |
| Molecular Formula | C12H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760mmHg |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.24900 |
| Flash Point | 181.4ºC |
| Exact Mass | 260.09100 |
| PSA | 99.66000 |
| LogP | 1.60046 |
| Vapour Pressure | 7.29E-06mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | SZLZINHKPROFHT-UHFFFAOYSA-N |
| SMILES | COc1cc(NN=C(C#N)C#N)cc(OC)c1OC |
| 3,4,5-Trimethoxyphenylhydrazine,hydrazone with carbonyl cyanide |
| Propanedinitrile,2-[2-(3,4,5-trimethoxyphenyl)hydrazinylidene] |
| MALONONITRILE,(3,4,5-TRIMETHOXYPHENYL)HYDRAZONO |
| (3,4,5-Trimethoxyphenyl)hydrazonomalononitrile |