3,4-bis(4-bromophenyl)pyrrole-2,5-dione
Modify Date: 2025-08-25 17:33:01
3,4-bis(4-bromophenyl)pyrrole-2,5-dione structure
|
Common Name | 3,4-bis(4-bromophenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 101422-55-3 | Molecular Weight | 407.05600 | |
| Density | 1.787 g/cm3 | Boiling Point | 523.785ºC at 760 mmHg | |
| Molecular Formula | C16H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.576ºC | |
| Name | 3,4-bis(4-bromophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.787 g/cm3 |
|---|---|
| Boiling Point | 523.785ºC at 760 mmHg |
| Molecular Formula | C16H9Br2NO2 |
| Molecular Weight | 407.05600 |
| Flash Point | 270.576ºC |
| Exact Mass | 404.90000 |
| PSA | 49.66000 |
| LogP | 4.05470 |
| InChIKey | RKSSTQUJOQCZMF-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccc(Br)cc2)=C1c1ccc(Br)cc1 |
|
~49%
3,4-bis(4-bromo... CAS#:101422-55-3 |
| Literature: Yeh, Hsiu-Chih; Wu, Wei-Ching; Wen, Yuh-Sheng; Dai, De-Chang; Wang, Juen-Kai; Chen, Chin-Ti Journal of Organic Chemistry, 2004 , vol. 69, # 19 p. 6455 - 6462 |
|
~%
3,4-bis(4-bromo... CAS#:101422-55-3 |
| Literature: Yeh, Hsiu-Chih; Chan, Li-Hsin; Wu, Wei-Ching; Chen, Chin-Ti Journal of Materials Chemistry, 2004 , vol. 14, # 8 p. 1293 - 1298 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Pyrrole-2,5-dione,3,4-bis(4-bromophenyl) |
| 3,4-Bis-(4-brom-phenyl)-pyrrol-2,5-dion |
| 3,4-bis(4-bromophenyl)maleimide |
| 3,4-bis-(4-bromo-phenyl)-pyrrole-2,5-dione |