diamyl maleate structure
|
Common Name | diamyl maleate | ||
|---|---|---|---|---|
| CAS Number | 10099-71-5 | Molecular Weight | 256.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diamyl maleate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24O4 |
|---|---|
| Molecular Weight | 256.33800 |
| Exact Mass | 256.16700 |
| PSA | 52.60000 |
| LogP | 3.00940 |
| Vapour Pressure | 0.000202mmHg at 25°C |
| InChIKey | NFCMRHDORQSGIS-KTKRTIGZSA-N |
| SMILES | CCCCCOC(=O)C=CC(=O)OCCCCC |
| HS Code | 2917190090 |
|---|
|
~%
diamyl maleate CAS#:10099-71-5 |
| Literature: Jeffery; Vogel Journal of the Chemical Society, 1948 , p. 663 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-butenedioic acid(2z)-, 1,4-dipentyl ester |