diethyl 4,6-dinitroisophthalate (en) structure
|
Common Name | diethyl 4,6-dinitroisophthalate (en) | ||
|---|---|---|---|---|
| CAS Number | 100143-85-9 | Molecular Weight | 312.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 4,6-dinitroisophthalate (en) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O8 |
|---|---|
| Molecular Weight | 312.23200 |
| Exact Mass | 312.05900 |
| PSA | 144.24000 |
| LogP | 2.90280 |
| InChIKey | XKZLICUVBJHUEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
diethyl 4,6-din... CAS#:100143-85-9 |
| Literature: Legge Journal of the American Chemical Society, 1947 , vol. 69, p. 2079,2083 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,6-Dinitro-isophthalsaeure-diethylester |
| 4,6-Dinitro-isophthalsaeure-diaethylester |
| 4,6-Dinitroisophthaloyl dichloride |
| 1,3-Benzenedicarbonyldichloride,4,6-dinitro |
| 4,6-DINITRO-1,3-BENZENEDICARBONYL CHLORIDE |
| 4,6-dinitro-isophthalic acid diethyl ester |
| 4,6-Dinitro-isophthaloylchlorid |
| 4,6-dinitrobenzene-1,3-dioyl dichloride |
| 4,6-dinitroisophthalic acid |
| 4,6-dinitroisophthaloyl chloride |