3,5-bis-(Phenylmethoxy)-2-pyridinecarboxylic acid
3,5-bis-(Phenylmethoxy)-2-pyridinecarboxylic acid structure
|
Common Name | 3,5-bis-(Phenylmethoxy)-2-pyridinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1000025-93-3 | Molecular Weight | 335.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17NO4 |
|---|---|
| Molecular Weight | 335.35300 |
| Exact Mass | 335.11600 |
| PSA | 68.65000 |
| LogP | 3.93780 |
| InChIKey | OEJYKWLDGWAOIF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-bis-benzyloxy-pyridine-2-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: CAS number of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is 1000025-93-3. |
| Q: What is the SMILES notation of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: SMILES notation of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is O=C(O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: Polar surface area (PSA) of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is 68.65000. |
| Q: What English synonyms does 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid have? |
| A: English synonyms of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid: 3,5-bis-benzyloxy-pyridine-2-carboxylic acid. |
| Q: What is the molecular formula of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: Molecular formula of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is C20H17NO4. |
| Q: What is the molecular weight of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: Molecular weight of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is 335.35300. |
| Q: What is the LogP of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: LogP of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is 3.93780. |
| Q: What is the English name of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: The English name of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid. |
| Q: What is the InChIKey of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid? |
| A: InChIKey of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is OEJYKWLDGWAOIF-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |