1-Boc-6-fluoro-1H-indole
1-Boc-6-fluoro-1H-indole structure
|
Common Name | 1-Boc-6-fluoro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 1000068-26-7 | Molecular Weight | 279.07200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15BFNO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15BFNO4 |
|---|---|
| Molecular Weight | 279.07200 |
| Exact Mass | 279.10800 |
| PSA | 71.69000 |
| LogP | 1.24340 |
| InChIKey | GARRUKBUEWVRCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c(B(O)O)cc2ccc(F)cc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(BOC)-6-fluoroindole-2-boronic acid |
| 1-Boc-6-Fluoro-1H-indole-2-boronic acid |
| [1-(tert-butoxycarbonyl)-6-fluoro-H-indol-2-yl]boronic acid |
| (1-(tert-Butoxycarbonyl)-6-fluoro-1H-indol-2-yl)boronic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: The English name of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. |
| Q: What is the InChIKey of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: InChIKey of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is GARRUKBUEWVRCV-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: Polar surface area (PSA) of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is 71.69000. |
| Q: What is the molecular weight of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: Molecular weight of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is 279.07200. |
| Q: What English synonyms does [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid have? |
| A: English synonyms of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid: N-(BOC)-6-fluoroindole-2-boronic acid, 1-Boc-6-Fluoro-1H-indole-2-boronic acid, [1-(tert-butoxycarbonyl)-6-fluoro-H-indol-2-yl]boronic acid, (1-(tert-Butoxycarbonyl)-6-fluoro-1H-indol-2-yl)boronic acid. |
| Q: What is the CAS number of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: CAS number of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is 1000068-26-7. |
| Q: What is the molecular formula of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: Molecular formula of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is C13H15BFNO4. |
| Q: What is the SMILES notation of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: SMILES notation of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is CC(C)(C)OC(=O)n1c(B(O)O)cc2ccc(F)cc21. |
| Q: What is the LogP of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid? |
| A: LogP of [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid is 1.24340. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |