4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid structure
|
Common Name | 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1000340-36-2 | Molecular Weight | 241.042 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H5BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.042 |
| Exact Mass | 239.953430 |
| PSA | 65.98000 |
| LogP | 2.34 |
| Index of Refraction | 1.766 |
| InChIKey | CGEPFCDRFZLRGQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c2nccc(Br)c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
| 4-Bromo-7-azaindole-3-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: Polar surface area (PSA) of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is 65.98000. |
| Q: What is the CAS number of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: CAS number of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is 1000340-36-2. |
| Q: What is the molecular weight of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: Molecular weight of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is 241.042. |
| Q: What is the LogP of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: LogP of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is 2.34. |
| Q: What is the SMILES notation of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: SMILES notation of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is O=C(O)c1c[nH]c2nccc(Br)c12. |
| Q: What is the English name of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: The English name of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid. |
| Q: What is the InChIKey of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: InChIKey of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is CGEPFCDRFZLRGQ-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid have? |
| A: English synonyms of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid: 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-Bromo-7-azaindole-3-carboxylic acid. |
| Q: What is the molecular formula of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid? |
| A: Molecular formula of 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is C8H5BrN2O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |