1H-Benzimidazole-1-carboxylicacid,6-bromo-,1,1-dimethylethylester
1H-Benzimidazole-1-carboxylicacid,6-bromo-,1,1-dimethylethylester structure
|
Common Name | 1H-Benzimidazole-1-carboxylicacid,6-bromo-,1,1-dimethylethylester | ||
|---|---|---|---|---|
| CAS Number | 1006899-77-9 | Molecular Weight | 297.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrN2O2 |
|---|---|
| Molecular Weight | 297.14800 |
| Exact Mass | 296.01600 |
| PSA | 44.12000 |
| LogP | 3.58200 |
| InChIKey | XLOBARPKKQPYLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cnc2ccc(Br)cc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 6-bromo-1h-benzimidazole-1-carboxylate |
| 6-bromo-1h-benzimidazole-1-carboxylic acid 1,1-dimethylethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: LogP of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is 3.58200. |
| Q: What is the CAS number of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: CAS number of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is 1006899-77-9. |
| Q: What is the molecular weight of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: Molecular weight of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is 297.14800. |
| Q: What is the molecular formula of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: Molecular formula of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is C12H13BrN2O2. |
| Q: What English synonyms does 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate have? |
| A: English synonyms of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate: tert-butyl 6-bromo-1h-benzimidazole-1-carboxylate, 6-bromo-1h-benzimidazole-1-carboxylic acid 1,1-dimethylethyl ester. |
| Q: What is the InChIKey of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: InChIKey of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is XLOBARPKKQPYLI-UHFFFAOYSA-N. |
| Q: What is the English name of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: The English name of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate. |
| Q: What is the SMILES notation of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: SMILES notation of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is CC(C)(C)OC(=O)n1cnc2ccc(Br)cc21. |
| Q: What is the polar surface area (PSA) of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate? |
| A: Polar surface area (PSA) of 1,1-dimethylethyl 6-bromo-1H-benzimidazole-1-carboxylate is 44.12000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |