6-Methoxy-2-(p-tolyl)benzo[d]thiazole
![6-Methoxy-2-(p-tolyl)benzo[d]thiazole Structure](https://image.chemsrc.com/caspic/432/101078-51-7.png)
6-Methoxy-2-(p-tolyl)benzo[d]thiazole structure
|
Common Name | 6-Methoxy-2-(p-tolyl)benzo[d]thiazole | ||
|---|---|---|---|---|
| CAS Number | 101078-51-7 | Molecular Weight | 255.33500 | |
| Density | N/A | Boiling Point | 403.8°C at 760 mmHg | |
| Molecular Formula | C15H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6-Methoxy-2-(p-tolyl)benzo[d]thiazole (CAS: 101078-51-7, molecular formula: C15H13NOS, molecular weight: 255.33500), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 403.8°C at 760 mmHg |
|---|---|
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.33500 |
| Exact Mass | 255.07200 |
| PSA | 50.36000 |
| LogP | 4.28030 |
| InChIKey | HYPBHVPYFUNVJM-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(-c3ccc(C)cc3)sc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
![6-Methoxybenzo[d]thiazole Structure](https://image.chemsrc.com/caspic/221/2942-13-4.png)
CAS#:2942-13-4
CAS#:104-87-0
CAS#:21011-45-0
CAS#:122-00-9
CAS#:6274-29-9
CAS#:824-79-3
CAS#:214279-40-0![6-methoxy-3H-benzo[d][1,2,3]dithiazole 2-oxide Structure](https://image.chemsrc.com/caspic/020/73011-26-4.png)
CAS#:73011-26-4
CAS#:33667-91-3
CAS#:874-60-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-methoxy-2-p-tolylbenzothiazole |
| 6-methoxy-2-(4-tolyl)-1,3-benzothiazole |
| 6-methoxy-2-(p-tolyl)benzo[d]thiazole |
| Benzothiazole,6-methoxy-2-(4-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: Boiling point of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is 403.8°C at 760 mmHg. |
| Q: What is the CAS number of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: CAS number of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is 101078-51-7. |
| Q: What is the molecular formula of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: Molecular formula of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is C15H13NOS. |
| Q: What is the SMILES notation of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: SMILES notation of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is COc1ccc2nc(-c3ccc(C)cc3)sc2c1. |
| Q: What is the English name of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: The English name of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole. |
| Q: What is the polar surface area (PSA) of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: Polar surface area (PSA) of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is 50.36000. |
| Q: What English synonyms does 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole have? |
| A: English synonyms of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole: 6-methoxy-2-p-tolylbenzothiazole, 6-methoxy-2-(4-tolyl)-1,3-benzothiazole, 6-methoxy-2-(p-tolyl)benzo[d]thiazole, Benzothiazole,6-methoxy-2-(4-methylphenyl). |
| Q: What are the upstream materials of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: Related upstream materials(CAS) of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole: 2942-13-4;104-87-0;21011-45-0;122-00-9;6274-29-9;824-79-3;214279-40-0;73011-26-4;33667-91-3;874-60-2. |
| Q: What is the InChIKey of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: InChIKey of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is HYPBHVPYFUNVJM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole? |
| A: Molecular weight of 6-methoxy-2-(4-methylphenyl)-1,3-benzothiazole is 255.33500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |