3-(4-Fluorophenyl)-indole
3-(4-Fluorophenyl)-indole structure
|
Common Name | 3-(4-Fluorophenyl)-indole | ||
|---|---|---|---|---|
| CAS Number | 101125-32-0 | Molecular Weight | 211.234 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 390.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H10FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.0±23.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Fluorophenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.5±25.0 °C at 760 mmHg |
| Molecular Formula | C14H10FN |
| Molecular Weight | 211.234 |
| Flash Point | 190.0±23.2 °C |
| Exact Mass | 211.079727 |
| PSA | 15.79000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | JFVIPMRWCFOHBG-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2c[nH]c3ccccc23)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-Fluorophenyl)-indole |
| 3-(4-Fluorophenyl)-1H-indole |
| 3-(4-Fluoro-phenyl)-1H-indole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(4-Fluorophenyl)-1H-indole? |
| A: LogP of 3-(4-Fluorophenyl)-1H-indole is 3.83. |
| Q: What is the CAS number of 3-(4-Fluorophenyl)-1H-indole? |
| A: CAS number of 3-(4-Fluorophenyl)-1H-indole is 101125-32-0. |
| Q: What is the molecular weight of 3-(4-Fluorophenyl)-1H-indole? |
| A: Molecular weight of 3-(4-Fluorophenyl)-1H-indole is 211.234. |
| Q: What is the polar surface area (PSA) of 3-(4-Fluorophenyl)-1H-indole? |
| A: Polar surface area (PSA) of 3-(4-Fluorophenyl)-1H-indole is 15.79000. |
| Q: What is the boiling point of 3-(4-Fluorophenyl)-1H-indole? |
| A: Boiling point of 3-(4-Fluorophenyl)-1H-indole is 390.5±25.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 3-(4-Fluorophenyl)-1H-indole? |
| A: SMILES notation of 3-(4-Fluorophenyl)-1H-indole is Fc1ccc(-c2c[nH]c3ccccc23)cc1. |
| Q: What is the English name of 3-(4-Fluorophenyl)-1H-indole? |
| A: The English name of 3-(4-Fluorophenyl)-1H-indole is 3-(4-Fluorophenyl)-1H-indole. |
| Q: What English synonyms does 3-(4-Fluorophenyl)-1H-indole have? |
| A: English synonyms of 3-(4-Fluorophenyl)-1H-indole: 3-(4-Fluorophenyl)-indole, 3-(4-Fluorophenyl)-1H-indole, 3-(4-Fluoro-phenyl)-1H-indole. |
| Q: What is the InChIKey of 3-(4-Fluorophenyl)-1H-indole? |
| A: InChIKey of 3-(4-Fluorophenyl)-1H-indole is JFVIPMRWCFOHBG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(4-Fluorophenyl)-1H-indole? |
| A: Molecular formula of 3-(4-Fluorophenyl)-1H-indole is C14H10FN. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |