5-methyl-2,4-dinitrobenzoic acid ethyl ester
5-methyl-2,4-dinitrobenzoic acid ethyl ester structure
|
Common Name | 5-methyl-2,4-dinitrobenzoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 103039-34-5 | Molecular Weight | 254.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-2,4-dinitrobenzoic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O6 |
|---|---|
| Molecular Weight | 254.19600 |
| Exact Mass | 254.05400 |
| PSA | 117.94000 |
| LogP | 3.03450 |
| InChIKey | IUNWYBCKKXSNTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)c([N+](=O)[O-])cc1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,6-dinitro-m-toluic acid ethyl ester |
| 5-methyl-2,4-dinitro-benzoic acid ethyl ester |
| 5-Methyl-2,4-dinitro-benzoesaeure-aethylester |
| ethyl 5-methyl-2,4-dinitrobenzoate |
| 2,6-Dinitro-m-toluylsaeure-ethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: Polar surface area (PSA) of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is 117.94000. |
| Q: What is the SMILES notation of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: SMILES notation of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is CCOC(=O)c1cc(C)c([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the English name of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: The English name of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is 5-methyl-2,4-dinitrobenzoic acid ethyl ester. |
| Q: What English synonyms does 5-methyl-2,4-dinitrobenzoic acid ethyl ester have? |
| A: English synonyms of 5-methyl-2,4-dinitrobenzoic acid ethyl ester: 4,6-dinitro-m-toluic acid ethyl ester, 5-methyl-2,4-dinitro-benzoic acid ethyl ester, 5-Methyl-2,4-dinitro-benzoesaeure-aethylester, ethyl 5-methyl-2,4-dinitrobenzoate, 2,6-Dinitro-m-toluylsaeure-ethylester. |
| Q: What is the molecular weight of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: Molecular weight of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is 254.19600. |
| Q: What is the LogP of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: LogP of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is 3.03450. |
| Q: What is the InChIKey of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: InChIKey of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is IUNWYBCKKXSNTK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: CAS number of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is 103039-34-5. |
| Q: What is the molecular formula of 5-methyl-2,4-dinitrobenzoic acid ethyl ester? |
| A: Molecular formula of 5-methyl-2,4-dinitrobenzoic acid ethyl ester is C10H10N2O6. |
| Q: What is the Chinese name of 103039-34-5? |
| A: Chinese name of 103039-34-5 is 103039-34-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |