Boc-HoSer-Obzl
Boc-HoSer-Obzl structure
|
Common Name | Boc-HoSer-Obzl | ||
|---|---|---|---|---|
| CAS Number | 105183-60-6 | Molecular Weight | 309.35800 | |
| Density | 1.154±0.06 g/cm3(Predicted) | Boiling Point | 467.4±45.0 °C(Predicted) | |
| Molecular Formula | C16H23NO5 | Melting Point | 58-59 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.154±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 467.4±45.0 °C(Predicted) |
| Melting Point | 58-59 °C |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.35800 |
| Exact Mass | 309.15800 |
| PSA | 84.86000 |
| LogP | 2.39640 |
| InChIKey | YQTGYJUMDNISEP-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCO)C(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:118399-28-3![Butanoicacid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-oxo-, phenylmethyl ester, (2S) structure](https://image.chemsrc.com/caspic/014/124994-66-7.png)
CAS#:124994-66-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| boc-hoser-obzl |
| boc-homoser-obzl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: LogP of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is 2.39640. |
| Q: What is the SMILES notation of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: SMILES notation of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is CC(C)(C)OC(=O)NC(CCO)C(=O)OCc1ccccc1. |
| Q: What is the molecular formula of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: Molecular formula of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is C16H23NO5. |
| Q: What is the molecular weight of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: Molecular weight of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is 309.35800. |
| Q: What are the downstream products of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: Related downstream products(CAS) of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester: 118399-28-3;124994-66-7. |
| Q: What is the boiling point of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: Boiling point of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is 467.4±45.0 °C(Predicted). |
| Q: What is the English name of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: The English name of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester. |
| Q: What is the CAS number of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: CAS number of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is 105183-60-6. |
| Q: What English synonyms does (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester have? |
| A: English synonyms of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester: boc-hoser-obzl, boc-homoser-obzl. |
| Q: What is the melting point of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester? |
| A: Melting point of (2S)-2-tert-butoxycarbonylamino-4-hydroxybutyric acid benzyl ester is 58-59 °C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |