4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE
![4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE Structure](https://image.chemsrc.com/caspic/146/105362-06-9.png)
4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE structure
|
Common Name | 4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 105362-06-9 | Molecular Weight | 234.27400 | |
| Density | 1.389g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.27400 |
| Flash Point | 222.8ºC |
| Exact Mass | 234.04600 |
| PSA | 85.61000 |
| LogP | 2.74470 |
| Vapour Pressure | 4.15E-08mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | QNDNSJKGUGRQDK-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc3c(c2)OCCO3)cs1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934100090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(2,3-DIHYDRO-... CAS#:105362-06-9 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 36, # 9 p. 1391 - 1393 |
![1-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)ethanone structure](https://image.chemsrc.com/caspic/391/2879-20-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: Boiling point of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 444.8ºC at 760 mmHg. |
| Q: What is the molecular weight of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: Molecular weight of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 234.27400. |
| Q: What is the InChIKey of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: InChIKey of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is QNDNSJKGUGRQDK-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: Related upstream materials(CAS) of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine: 2879-20-1. |
| Q: What is the SMILES notation of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: SMILES notation of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is Nc1nc(-c2ccc3c(c2)OCCO3)cs1. |
| Q: What is the English name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: The English name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine. |
| Q: What is the molecular formula of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: Molecular formula of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is C11H10N2O2S. |
| Q: What is the LogP of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: LogP of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 2.74470. |
| Q: What is the polar surface area (PSA) of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: Polar surface area (PSA) of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 85.61000. |
| Q: What is the CAS number of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine? |
| A: CAS number of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is 105362-06-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |