6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester
6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester structure
|
Common Name | 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 110060-70-3 | Molecular Weight | 296.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16O4 |
|---|---|
| Molecular Weight | 296.31700 |
| Exact Mass | 296.10500 |
| PSA | 48.67000 |
| LogP | 4.18850 |
| InChIKey | VTPLPAMKVRPRIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(OCc3ccccc3)cc2o1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:13196-11-7
CAS#:334022-87-6
CAS#:906448-92-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Benzyloxy-benzofuran-2-carbonsaeure-aethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: SMILES notation of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is CCOC(=O)c1cc2ccc(OCc3ccccc3)cc2o1. |
| Q: What is the molecular formula of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: Molecular formula of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is C18H16O4. |
| Q: What is the Chinese name of 110060-70-3? |
| A: Chinese name of 110060-70-3 is 110060-70-3. |
| Q: What is the polar surface area (PSA) of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: Polar surface area (PSA) of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is 48.67000. |
| Q: What are the downstream products of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: Related downstream products(CAS) of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester: 13196-11-7;334022-87-6;906448-92-8. |
| Q: What is the LogP of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: LogP of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is 4.18850. |
| Q: What is the English name of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: The English name of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester. |
| Q: What is the InChIKey of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: InChIKey of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is VTPLPAMKVRPRIL-UHFFFAOYSA-N. |
| Q: What English synonyms does 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester have? |
| A: English synonyms of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester: 6-Benzyloxy-benzofuran-2-carbonsaeure-aethylester. |
| Q: What is the CAS number of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester? |
| A: CAS number of 6-benzyloxy-benzofuran-2-carboxylic acid ethyl ester is 110060-70-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |