4-nitrobutanoic acid t-butyl ester
4-nitrobutanoic acid t-butyl ester structure
|
Common Name | 4-nitrobutanoic acid t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 110106-95-1 | Molecular Weight | 189.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-nitrobutanoic acid t-butyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15NO4 |
|---|---|
| Molecular Weight | 189.20900 |
| Exact Mass | 189.10000 |
| PSA | 72.12000 |
| LogP | 1.90820 |
| InChIKey | ZVXMQRIUOUXFAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:16488-43-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 4-nitrobutyrate |
| .4-nitrobutanoic acid 1,1-dimethylethyl ester |
| .tert-Butyl 4-nitrobutanoate |
| .tert.-butyl 4-nitrobutyrate |
| .4-nitro-butyric acid t-butyl ester |
| .4-nitrobutyric acid t-butyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-nitrobutanoic acid t-butyl ester? |
| A: CAS number of 4-nitrobutanoic acid t-butyl ester is 110106-95-1. |
| Q: What is the molecular formula of 4-nitrobutanoic acid t-butyl ester? |
| A: Molecular formula of 4-nitrobutanoic acid t-butyl ester is C8H15NO4. |
| Q: What is the molecular weight of 4-nitrobutanoic acid t-butyl ester? |
| A: Molecular weight of 4-nitrobutanoic acid t-butyl ester is 189.20900. |
| Q: What is the polar surface area (PSA) of 4-nitrobutanoic acid t-butyl ester? |
| A: Polar surface area (PSA) of 4-nitrobutanoic acid t-butyl ester is 72.12000. |
| Q: What is the InChIKey of 4-nitrobutanoic acid t-butyl ester? |
| A: InChIKey of 4-nitrobutanoic acid t-butyl ester is ZVXMQRIUOUXFAZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-nitrobutanoic acid t-butyl ester? |
| A: SMILES notation of 4-nitrobutanoic acid t-butyl ester is CC(C)(C)OC(=O)CCC[N+](=O)[O-]. |
| Q: What English synonyms does 4-nitrobutanoic acid t-butyl ester have? |
| A: English synonyms of 4-nitrobutanoic acid t-butyl ester: tert-butyl 4-nitrobutyrate, .4-nitrobutanoic acid 1,1-dimethylethyl ester, .tert-Butyl 4-nitrobutanoate, .tert.-butyl 4-nitrobutyrate, .4-nitro-butyric acid t-butyl ester, .4-nitrobutyric acid t-butyl ester. |
| Q: What is the English name of 4-nitrobutanoic acid t-butyl ester? |
| A: The English name of 4-nitrobutanoic acid t-butyl ester is 4-nitrobutanoic acid t-butyl ester. |
| Q: What is the LogP of 4-nitrobutanoic acid t-butyl ester? |
| A: LogP of 4-nitrobutanoic acid t-butyl ester is 1.90820. |
| Q: What is the Chinese name of 110106-95-1? |
| A: Chinese name of 110106-95-1 is 110106-95-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |