(S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate
(S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate structure
|
Common Name | (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 1142223-08-2 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 46.53000 |
| LogP | 2.44890 |
| InChIKey | PXBFBXFVUPMAJK-LBPRGKRZSA-N |
| SMILES | COC(=O)CC(c1cccc(O)c1)C1CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1142214-62-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: Related downstream products(CAS) of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate: 1142214-62-7. |
| Q: What is the CAS number of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: CAS number of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is 1142223-08-2. |
| Q: What is the molecular weight of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: Molecular weight of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is 220.26400. |
| Q: What is the polar surface area (PSA) of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: Polar surface area (PSA) of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is 46.53000. |
| Q: What is the SMILES notation of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: SMILES notation of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is COC(=O)CC(c1cccc(O)c1)C1CC1. |
| Q: What English synonyms does (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate have? |
| A: English synonyms of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate: methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. |
| Q: What is the InChIKey of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: InChIKey of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is PXBFBXFVUPMAJK-LBPRGKRZSA-N. |
| Q: What is the English name of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: The English name of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. |
| Q: What is the LogP of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: LogP of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is 2.44890. |
| Q: What is the molecular formula of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate? |
| A: Molecular formula of (S)-methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate is C13H16O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |