tert-Butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate
tert-Butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate structure
|
Common Name | tert-Butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 114676-61-8 | Molecular Weight | 201.263 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 282.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.7±25.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.5±33.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.263 |
| Flash Point | 124.7±25.4 °C |
| Exact Mass | 201.136490 |
| PSA | 49.77000 |
| LogP | 0.42 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | BXZADLGAYWRZCR-JGVFFNPUSA-N |
| SMILES | CC1CC(O)CN1C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:477293-60-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methyl-2-propanyl (2S,4R)-4-hydroxy-2-methyl-1-pyrrolidinecarboxylate |
| tert-Butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: Polar surface area (PSA) of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is 49.77000. |
| Q: What is the boiling point of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: Boiling point of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is 282.5±33.0 °C at 760 mmHg. |
| Q: What is the CAS number of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: CAS number of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is 114676-61-8. |
| Q: What English synonyms does tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate have? |
| A: English synonyms of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate: 2-Methyl-2-propanyl (2S,4R)-4-hydroxy-2-methyl-1-pyrrolidinecarboxylate, tert-Butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate. |
| Q: What is the LogP of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: LogP of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is 0.42. |
| Q: What is the InChIKey of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: InChIKey of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is BXZADLGAYWRZCR-JGVFFNPUSA-N. |
| Q: What is the English name of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: The English name of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate. |
| Q: What is the SMILES notation of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: SMILES notation of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is CC1CC(O)CN1C(=O)OC(C)(C)C. |
| Q: What is the molecular formula of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: Molecular formula of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is C10H19NO3. |
| Q: What is the molecular weight of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate? |
| A: Molecular weight of tert-butyl (2S,4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate is 201.263. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |