METHYL4-CHLOROQUINOLINE-2-CARBOXYLATE
METHYL4-CHLOROQUINOLINE-2-CARBOXYLATE structure
|
Common Name | METHYL4-CHLOROQUINOLINE-2-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 114935-92-1 | Molecular Weight | 221.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-chloroquinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClNO2 |
|---|---|
| Molecular Weight | 221.64000 |
| Exact Mass | 221.02400 |
| PSA | 39.19000 |
| LogP | 2.67480 |
| InChIKey | AAHYMHHQOLSODU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c2ccccc2n1 |
| Storage condition | 2-8°C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Quinolinecarboxylic acid,4-chloro-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl 4-chloroquinoline-2-carboxylate? |
| A: The English name of methyl 4-chloroquinoline-2-carboxylate is methyl 4-chloroquinoline-2-carboxylate. |
| Q: What is the LogP of methyl 4-chloroquinoline-2-carboxylate? |
| A: LogP of methyl 4-chloroquinoline-2-carboxylate is 2.67480. |
| Q: What is the molecular weight of methyl 4-chloroquinoline-2-carboxylate? |
| A: Molecular weight of methyl 4-chloroquinoline-2-carboxylate is 221.64000. |
| Q: What is the InChIKey of methyl 4-chloroquinoline-2-carboxylate? |
| A: InChIKey of methyl 4-chloroquinoline-2-carboxylate is AAHYMHHQOLSODU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 4-chloroquinoline-2-carboxylate? |
| A: Molecular formula of methyl 4-chloroquinoline-2-carboxylate is C11H8ClNO2. |
| Q: What is the CAS number of methyl 4-chloroquinoline-2-carboxylate? |
| A: CAS number of methyl 4-chloroquinoline-2-carboxylate is 114935-92-1. |
| Q: What is the SMILES notation of methyl 4-chloroquinoline-2-carboxylate? |
| A: SMILES notation of methyl 4-chloroquinoline-2-carboxylate is COC(=O)c1cc(Cl)c2ccccc2n1. |
| Q: What are the storage conditions for methyl 4-chloroquinoline-2-carboxylate? |
| A: Storage conditions for methyl 4-chloroquinoline-2-carboxylate: 2-8°C. |
| Q: What English synonyms does methyl 4-chloroquinoline-2-carboxylate have? |
| A: English synonyms of methyl 4-chloroquinoline-2-carboxylate: 2-Quinolinecarboxylic acid,4-chloro-,methyl ester. |
| Q: What is the polar surface area (PSA) of methyl 4-chloroquinoline-2-carboxylate? |
| A: Polar surface area (PSA) of methyl 4-chloroquinoline-2-carboxylate is 39.19000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |