2,4-Dihydroxy-5-isopropylbenzoic acid
2,4-Dihydroxy-5-isopropylbenzoic acid structure
|
Common Name | 2,4-Dihydroxy-5-isopropylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1184181-48-3 | Molecular Weight | 196.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dihydroxy-5-propan-2-ylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O4 |
|---|---|
| Molecular Weight | 196.20000 |
| Exact Mass | 196.07400 |
| PSA | 77.76000 |
| LogP | 1.91940 |
| InChIKey | JAMMFVLHQOLNOP-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(=O)O)c(O)cc1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| QC-4439 |
| CL4158 |
| 2,4-dihydroxy-5-isopropylbenzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: Molecular weight of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is 196.20000. |
| Q: What is the SMILES notation of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: SMILES notation of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is CC(C)c1cc(C(=O)O)c(O)cc1O. |
| Q: What is the English name of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: The English name of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is 2,4-dihydroxy-5-propan-2-ylbenzoic acid. |
| Q: What is the polar surface area (PSA) of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: Polar surface area (PSA) of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is 77.76000. |
| Q: What is the molecular formula of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: Molecular formula of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is C10H12O4. |
| Q: What English synonyms does 2,4-dihydroxy-5-propan-2-ylbenzoic acid have? |
| A: English synonyms of 2,4-dihydroxy-5-propan-2-ylbenzoic acid: QC-4439, CL4158, 2,4-dihydroxy-5-isopropylbenzoic acid. |
| Q: What is the InChIKey of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: InChIKey of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is JAMMFVLHQOLNOP-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: LogP of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is 1.91940. |
| Q: What is the CAS number of 2,4-dihydroxy-5-propan-2-ylbenzoic acid? |
| A: CAS number of 2,4-dihydroxy-5-propan-2-ylbenzoic acid is 1184181-48-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |